C18H22N2O2S — CID 121094282
N-cyclohexyl-4-[(4-methyl-1,3-thiazol-2-yl)methoxy]benzamide (PubChem CID 121094282) has the molecular formula C18H22N2O2S and a molecular weight of 330.45 g/mol. Its IUPAC name is N-cyclohexyl-4-[(4-methyl-1,3-thiazol-2-yl)methoxy]benzamide.
| Compound Name | N-cyclohexyl-4-[(4-methyl-1,3-thiazol-2-yl)methoxy]benzamide |
|---|---|
| PubChem CID | 121094282 |
| Molecular Formula | C18H22N2O2S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | N-cyclohexyl-4-[(4-methyl-1,3-thiazol-2-yl)methoxy]benzamide |
| SMILES | Cc1csc(COc2ccc(C(=O)NC3CCCCC3)cc2)n1 |
| InChI | InChI=1S/C18H22N2O2S/c1-13-12-23-17(19-13)11-22-16-9-7-14(8-10-16)18(21)20-15-5-3-2-4-6-15/h7-10,12,15H,2-6,11H2,1H3,(H,20,21) |
| InChIKey | ITFIAQSXJNKXLD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |