C24H25N3O3S — CID 86834806
N-cyclohexyl-4-[[4-(1,3-thiazol-4-ylmethoxy)benzoyl]amino]benzamide (PubChem CID 86834806) has the molecular formula C24H25N3O3S and a molecular weight of 435.55 g/mol. Its IUPAC name is N-cyclohexyl-4-[[4-(1,3-thiazol-4-ylmethoxy)benzoyl]amino]benzamide.
| Compound Name | N-cyclohexyl-4-[[4-(1,3-thiazol-4-ylmethoxy)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 86834806 |
| Molecular Formula | C24H25N3O3S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | N-cyclohexyl-4-[[4-(1,3-thiazol-4-ylmethoxy)benzoyl]amino]benzamide |
| SMILES | O=C(Nc1ccc(C(=O)NC2CCCCC2)cc1)c1ccc(OCc2cscn2)cc1 |
| InChI | InChI=1S/C24H25N3O3S/c28-23(26-19-4-2-1-3-5-19)17-6-10-20(11-7-17)27-24(29)18-8-12-22(13-9-18)30-14-21-15-31-16-25-21/h6-13,15-16,19H,1-5,14H2,(H,26,28)(H,27,29) |
| InChIKey | NDXLCJKYELMHOZ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |