C7H8N2OS — CID 63240261
2-(2-isocyanatoethyl)-4-methyl-1,3-thiazole (PubChem CID 63240261) has the molecular formula C7H8N2OS and a molecular weight of 168.22 g/mol. Its IUPAC name is 2-(2-isocyanatoethyl)-4-methyl-1,3-thiazole.
| Compound Name | 2-(2-isocyanatoethyl)-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 63240261 |
| Molecular Formula | C7H8N2OS |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | 2-(2-isocyanatoethyl)-4-methyl-1,3-thiazole |
| SMILES | Cc1csc(CCN=C=O)n1 |
| InChI | InChI=1S/C7H8N2OS/c1-6-4-11-7(9-6)2-3-8-5-10/h4H,2-3H2,1H3 |
| InChIKey | NRWNEFLANDAOOX-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|