C6H10BrNOS — CID 154976464
2-(4-methyl-1,3-thiazol-2-yl)ethanol;hydrobromide (PubChem CID 154976464) has the molecular formula C6H10BrNOS and a molecular weight of 224.12 g/mol. Its IUPAC name is 2-(4-methyl-1,3-thiazol-2-yl)ethanol;hydrobromide.
| Compound Name | 2-(4-methyl-1,3-thiazol-2-yl)ethanol;hydrobromide |
|---|---|
| PubChem CID | 154976464 |
| Molecular Formula | C6H10BrNOS |
| Molecular Weight | 224.12 g/mol |
| Exact Mass | 222.97 |
| IUPAC Name | 2-(4-methyl-1,3-thiazol-2-yl)ethanol;hydrobromide |
| SMILES | Br.Cc1csc(CCO)n1 |
| InChI | InChI=1S/C6H9NOS.BrH/c1-5-4-9-6(7-5)2-3-8;/h4,8H,2-3H2,1H3;1H |
| InChIKey | DHQASUFJBSFSJW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.12 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |