C7H12N2OS — CID 115087647
2-[4-(1-aminoethyl)-1,3-thiazol-2-yl]ethanol (PubChem CID 115087647) has the molecular formula C7H12N2OS and a molecular weight of 172.25 g/mol. Its IUPAC name is 2-[4-(1-aminoethyl)-1,3-thiazol-2-yl]ethanol.
| Compound Name | 2-[4-(1-aminoethyl)-1,3-thiazol-2-yl]ethanol |
|---|---|
| PubChem CID | 115087647 |
| Molecular Formula | C7H12N2OS |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 2-[4-(1-aminoethyl)-1,3-thiazol-2-yl]ethanol |
| SMILES | CC(N)c1csc(CCO)n1 |
| InChI | InChI=1S/C7H12N2OS/c1-5(8)6-4-11-7(9-6)2-3-10/h4-5,10H,2-3,8H2,1H3 |
| InChIKey | TZRMZPFMAPIDLF-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |