C9H15BrN2S — CID 106844765
4-bromo-N-[(4-methyl-1,3-thiazol-2-yl)methyl]butan-1-amine (PubChem CID 106844765) has the molecular formula C9H15BrN2S and a molecular weight of 263.20 g/mol. Its IUPAC name is 4-bromo-N-[(4-methyl-1,3-thiazol-2-yl)methyl]butan-1-amine.
| Compound Name | 4-bromo-N-[(4-methyl-1,3-thiazol-2-yl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 106844765 |
| Molecular Formula | C9H15BrN2S |
| Molecular Weight | 263.20 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | 4-bromo-N-[(4-methyl-1,3-thiazol-2-yl)methyl]butan-1-amine |
| SMILES | Cc1csc(CNCCCCBr)n1 |
| InChI | InChI=1S/C9H15BrN2S/c1-8-7-13-9(12-8)6-11-5-3-2-4-10/h7,11H,2-6H2,1H3 |
| InChIKey | RTTDCVFUBDWGAB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.20 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|