C8H15N3O2S2 — CID 104770025
3-[(4-methyl-1,3-thiazol-2-yl)methylamino]propane-1-sulfonamide (PubChem CID 104770025) has the molecular formula C8H15N3O2S2 and a molecular weight of 249.36 g/mol. Its IUPAC name is 3-[(4-methyl-1,3-thiazol-2-yl)methylamino]propane-1-sulfonamide.
| Compound Name | 3-[(4-methyl-1,3-thiazol-2-yl)methylamino]propane-1-sulfonamide |
|---|---|
| PubChem CID | 104770025 |
| Molecular Formula | C8H15N3O2S2 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 3-[(4-methyl-1,3-thiazol-2-yl)methylamino]propane-1-sulfonamide |
| SMILES | Cc1csc(CNCCCS(N)(=O)=O)n1 |
| InChI | InChI=1S/C8H15N3O2S2/c1-7-6-14-8(11-7)5-10-3-2-4-15(9,12)13/h6,10H,2-5H2,1H3,(H2,9,12,13) |
| InChIKey | GBDGLRRPUHDSIA-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|