C14H19N3S — CID 113290648
3-[3-[(4-methyl-1,3-thiazol-2-yl)methylamino]propyl]aniline (PubChem CID 113290648) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is 3-[3-[(4-methyl-1,3-thiazol-2-yl)methylamino]propyl]aniline.
| Compound Name | 3-[3-[(4-methyl-1,3-thiazol-2-yl)methylamino]propyl]aniline |
|---|---|
| PubChem CID | 113290648 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 3-[3-[(4-methyl-1,3-thiazol-2-yl)methylamino]propyl]aniline |
| SMILES | Cc1csc(CNCCCc2cccc(N)c2)n1 |
| InChI | InChI=1S/C14H19N3S/c1-11-10-18-14(17-11)9-16-7-3-5-12-4-2-6-13(15)8-12/h2,4,6,8,10,16H,3,5,7,9,15H2,1H3 |
| InChIKey | NBIRMIFCKBNDCX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|