C17H21FN2O2S — CID 70349133
ethyl 2-[2-[[3-(3-fluorophenyl)propylamino]methyl]-1,3-thiazol-4-yl]acetate (PubChem CID 70349133) has the molecular formula C17H21FN2O2S and a molecular weight of 336.43 g/mol. Its IUPAC name is ethyl 2-[2-[[3-(3-fluorophenyl)propylamino]methyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[[3-(3-fluorophenyl)propylamino]methyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 70349133 |
| Molecular Formula | C17H21FN2O2S |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | ethyl 2-[2-[[3-(3-fluorophenyl)propylamino]methyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(CNCCCc2cccc(F)c2)n1 |
| InChI | InChI=1S/C17H21FN2O2S/c1-2-22-17(21)10-15-12-23-16(20-15)11-19-8-4-6-13-5-3-7-14(18)9-13/h3,5,7,9,12,19H,2,4,6,8,10-11H2,1H3 |
| InChIKey | MIMPNACXVWTMMB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|