C7H11FN2S — CID 80695663
2-fluoro-N-[(4-methyl-1,3-thiazol-2-yl)methyl]ethanamine (PubChem CID 80695663) has the molecular formula C7H11FN2S and a molecular weight of 174.24 g/mol. Its IUPAC name is 2-fluoro-N-[(4-methyl-1,3-thiazol-2-yl)methyl]ethanamine.
| Compound Name | 2-fluoro-N-[(4-methyl-1,3-thiazol-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 80695663 |
| Molecular Formula | C7H11FN2S |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | 2-fluoro-N-[(4-methyl-1,3-thiazol-2-yl)methyl]ethanamine |
| SMILES | Cc1csc(CNCCF)n1 |
| InChI | InChI=1S/C7H11FN2S/c1-6-5-11-7(10-6)4-9-3-2-8/h5,9H,2-4H2,1H3 |
| InChIKey | XSONUULDDWZEBN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|