C10H18N2O2S — CID 103992433
2-[3-[(4-methyl-1,3-thiazol-2-yl)methylamino]propoxy]ethanol (PubChem CID 103992433) has the molecular formula C10H18N2O2S and a molecular weight of 230.33 g/mol. Its IUPAC name is 2-[3-[(4-methyl-1,3-thiazol-2-yl)methylamino]propoxy]ethanol.
| Compound Name | 2-[3-[(4-methyl-1,3-thiazol-2-yl)methylamino]propoxy]ethanol |
|---|---|
| PubChem CID | 103992433 |
| Molecular Formula | C10H18N2O2S |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 2-[3-[(4-methyl-1,3-thiazol-2-yl)methylamino]propoxy]ethanol |
| SMILES | Cc1csc(CNCCCOCCO)n1 |
| InChI | InChI=1S/C10H18N2O2S/c1-9-8-15-10(12-9)7-11-3-2-5-14-6-4-13/h8,11,13H,2-7H2,1H3 |
| InChIKey | KFQSSTMZGMLZSM-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|