C11H21N3OS — CID 78992604
N'-(2-methoxyethyl)-N'-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]ethane-1,2-diamine (PubChem CID 78992604) has the molecular formula C11H21N3OS and a molecular weight of 243.38 g/mol. Its IUPAC name is N'-(2-methoxyethyl)-N'-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]ethane-1,2-diamine.
| Compound Name | N'-(2-methoxyethyl)-N'-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 78992604 |
| Molecular Formula | C11H21N3OS |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | N'-(2-methoxyethyl)-N'-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]ethane-1,2-diamine |
| SMILES | COCCN(C)CCNCc1nc(C)cs1 |
| InChI | InChI=1S/C11H21N3OS/c1-10-9-16-11(13-10)8-12-4-5-14(2)6-7-15-3/h9,12H,4-8H2,1-3H3 |
| InChIKey | CHLKJAUNAODEQA-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|