C13H21IN2O — CID 65479419
N-[(4-iodophenyl)methyl]-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine (PubChem CID 65479419) has the molecular formula C13H21IN2O and a molecular weight of 348.23 g/mol. Its IUPAC name is N-[(4-iodophenyl)methyl]-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine.
| Compound Name | N-[(4-iodophenyl)methyl]-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 65479419 |
| Molecular Formula | C13H21IN2O |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | N-[(4-iodophenyl)methyl]-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine |
| SMILES | COCCN(C)CCNCc1ccc(I)cc1 |
| InChI | InChI=1S/C13H21IN2O/c1-16(9-10-17-2)8-7-15-11-12-3-5-13(14)6-4-12/h3-6,15H,7-11H2,1-2H3 |
| InChIKey | XJCNLHUQRCWXSI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|