C13H22N2O3 — CID 62842890
4-[[2-[2-methoxyethyl(methyl)amino]ethylamino]methyl]benzene-1,3-diol (PubChem CID 62842890) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is 4-[[2-[2-methoxyethyl(methyl)amino]ethylamino]methyl]benzene-1,3-diol.
| Compound Name | 4-[[2-[2-methoxyethyl(methyl)amino]ethylamino]methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 62842890 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 4-[[2-[2-methoxyethyl(methyl)amino]ethylamino]methyl]benzene-1,3-diol |
| SMILES | COCCN(C)CCNCc1ccc(O)cc1O |
| InChI | InChI=1S/C13H22N2O3/c1-15(7-8-18-2)6-5-14-10-11-3-4-12(16)9-13(11)17/h3-4,9,14,16-17H,5-8,10H2,1-2H3 |
| InChIKey | CVOZVIPTZOZMNO-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|