C10H19N3OS — CID 62844142
N'-(2-methoxyethyl)-N'-methyl-N-(1,3-thiazol-5-ylmethyl)ethane-1,2-diamine (PubChem CID 62844142) has the molecular formula C10H19N3OS and a molecular weight of 229.35 g/mol. Its IUPAC name is N'-(2-methoxyethyl)-N'-methyl-N-(1,3-thiazol-5-ylmethyl)ethane-1,2-diamine.
| Compound Name | N'-(2-methoxyethyl)-N'-methyl-N-(1,3-thiazol-5-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62844142 |
| Molecular Formula | C10H19N3OS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | N'-(2-methoxyethyl)-N'-methyl-N-(1,3-thiazol-5-ylmethyl)ethane-1,2-diamine |
| SMILES | COCCN(C)CCNCc1cncs1 |
| InChI | InChI=1S/C10H19N3OS/c1-13(5-6-14-2)4-3-11-7-10-8-12-9-15-10/h8-9,11H,3-7H2,1-2H3 |
| InChIKey | RHOLHUWPUPPYMY-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|