C14H27N3OS — CID 62923091
N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine (PubChem CID 62923091) has the molecular formula C14H27N3OS and a molecular weight of 285.46 g/mol. Its IUPAC name is N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine.
| Compound Name | N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 62923091 |
| Molecular Formula | C14H27N3OS |
| Molecular Weight | 285.46 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine |
| SMILES | COCCN(C)CCNCc1cnc(C(C)(C)C)s1 |
| InChI | InChI=1S/C14H27N3OS/c1-14(2,3)13-16-11-12(19-13)10-15-6-7-17(4)8-9-18-5/h11,15H,6-10H2,1-5H3 |
| InChIKey | XOZHUYUPHCPONF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.46 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|