C13H21F3N2S — CID 115491448
N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-5,5,5-trifluoropentan-1-amine (PubChem CID 115491448) has the molecular formula C13H21F3N2S and a molecular weight of 294.39 g/mol. Its IUPAC name is N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-5,5,5-trifluoropentan-1-amine.
| Compound Name | N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-5,5,5-trifluoropentan-1-amine |
|---|---|
| PubChem CID | 115491448 |
| Molecular Formula | C13H21F3N2S |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-5,5,5-trifluoropentan-1-amine |
| SMILES | CC(C)(C)c1ncc(CNCCCCC(F)(F)F)s1 |
| InChI | InChI=1S/C13H21F3N2S/c1-12(2,3)11-18-9-10(19-11)8-17-7-5-4-6-13(14,15)16/h9,17H,4-8H2,1-3H3 |
| InChIKey | SKWLWFHXVMHISE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|