C12H12N2OS — CID 105126213
1-(2,6-dimethyl-3-pyridinyl)-2-(1,3-thiazol-5-yl)ethanone (PubChem CID 105126213) has the molecular formula C12H12N2OS and a molecular weight of 232.31 g/mol. Its IUPAC name is 1-(2,6-dimethyl-3-pyridinyl)-2-(1,3-thiazol-5-yl)ethanone.
| Compound Name | 1-(2,6-dimethyl-3-pyridinyl)-2-(1,3-thiazol-5-yl)ethanone |
|---|---|
| PubChem CID | 105126213 |
| Molecular Formula | C12H12N2OS |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 1-(2,6-dimethyl-3-pyridinyl)-2-(1,3-thiazol-5-yl)ethanone |
| SMILES | Cc1ccc(C(=O)Cc2cncs2)c(C)n1 |
| InChI | InChI=1S/C12H12N2OS/c1-8-3-4-11(9(2)14-8)12(15)5-10-6-13-7-16-10/h3-4,6-7H,5H2,1-2H3 |
| InChIKey | ILYCHGKAYZWQMF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |