C11H9ClN2OS — CID 112642327
1-(2-amino-4-chlorophenyl)-2-(1,3-thiazol-5-yl)ethanone (PubChem CID 112642327) has the molecular formula C11H9ClN2OS and a molecular weight of 252.73 g/mol. Its IUPAC name is 1-(2-amino-4-chlorophenyl)-2-(1,3-thiazol-5-yl)ethanone.
| Compound Name | 1-(2-amino-4-chlorophenyl)-2-(1,3-thiazol-5-yl)ethanone |
|---|---|
| PubChem CID | 112642327 |
| Molecular Formula | C11H9ClN2OS |
| Molecular Weight | 252.73 g/mol |
| Exact Mass | 252.01 |
| IUPAC Name | 1-(2-amino-4-chlorophenyl)-2-(1,3-thiazol-5-yl)ethanone |
| SMILES | Nc1cc(Cl)ccc1C(=O)Cc1cncs1 |
| InChI | InChI=1S/C11H9ClN2OS/c12-7-1-2-9(10(13)3-7)11(15)4-8-5-14-6-16-8/h1-3,5-6H,4,13H2 |
| InChIKey | HALPHDOWZDOTHM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.73 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|