C10H7ClN2OS — CID 105126307
1-(3-chloro-4-pyridinyl)-2-(1,3-thiazol-5-yl)ethanone (PubChem CID 105126307) has the molecular formula C10H7ClN2OS and a molecular weight of 238.70 g/mol. Its IUPAC name is 1-(3-chloro-4-pyridinyl)-2-(1,3-thiazol-5-yl)ethanone.
| Compound Name | 1-(3-chloro-4-pyridinyl)-2-(1,3-thiazol-5-yl)ethanone |
|---|---|
| PubChem CID | 105126307 |
| Molecular Formula | C10H7ClN2OS |
| Molecular Weight | 238.70 g/mol |
| Exact Mass | 238.00 |
| IUPAC Name | 1-(3-chloro-4-pyridinyl)-2-(1,3-thiazol-5-yl)ethanone |
| SMILES | O=C(Cc1cncs1)c1ccncc1Cl |
| InChI | InChI=1S/C10H7ClN2OS/c11-9-5-12-2-1-8(9)10(14)3-7-4-13-6-15-7/h1-2,4-6H,3H2 |
| InChIKey | BRIDLEFHKBYWKP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.70 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |