C9H10ClNO3S — CID 114983965
1-(3-chloro-4-pyridinyl)-3-methylsulfonylpropan-1-one (PubChem CID 114983965) has the molecular formula C9H10ClNO3S and a molecular weight of 247.70 g/mol. Its IUPAC name is 1-(3-chloro-4-pyridinyl)-3-methylsulfonylpropan-1-one.
| Compound Name | 1-(3-chloro-4-pyridinyl)-3-methylsulfonylpropan-1-one |
|---|---|
| PubChem CID | 114983965 |
| Molecular Formula | C9H10ClNO3S |
| Molecular Weight | 247.70 g/mol |
| Exact Mass | 247.01 |
| IUPAC Name | 1-(3-chloro-4-pyridinyl)-3-methylsulfonylpropan-1-one |
| SMILES | CS(=O)(=O)CCC(=O)c1ccncc1Cl |
| InChI | InChI=1S/C9H10ClNO3S/c1-15(13,14)5-3-9(12)7-2-4-11-6-8(7)10/h2,4,6H,3,5H2,1H3 |
| InChIKey | LUQBGBVIWLLAPE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.70 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |