C10H9ClF3NO — CID 105123407
1-(3-chloro-4-pyridinyl)-5,5,5-trifluoropentan-1-one (PubChem CID 105123407) has the molecular formula C10H9ClF3NO and a molecular weight of 251.63 g/mol. Its IUPAC name is 1-(3-chloro-4-pyridinyl)-5,5,5-trifluoropentan-1-one.
| Compound Name | 1-(3-chloro-4-pyridinyl)-5,5,5-trifluoropentan-1-one |
|---|---|
| PubChem CID | 105123407 |
| Molecular Formula | C10H9ClF3NO |
| Molecular Weight | 251.63 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | 1-(3-chloro-4-pyridinyl)-5,5,5-trifluoropentan-1-one |
| SMILES | O=C(CCCC(F)(F)F)c1ccncc1Cl |
| InChI | InChI=1S/C10H9ClF3NO/c11-8-6-15-5-3-7(8)9(16)2-1-4-10(12,13)14/h3,5-6H,1-2,4H2 |
| InChIKey | YNWDVEPOOPVJFV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.63 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |