C10H13ClN2O3S — CID 81226430
4-chloro-N-(3-methylsulfonylpropyl)pyridine-3-carboxamide (PubChem CID 81226430) has the molecular formula C10H13ClN2O3S and a molecular weight of 276.74 g/mol. Its IUPAC name is 4-chloro-N-(3-methylsulfonylpropyl)pyridine-3-carboxamide.
| Compound Name | 4-chloro-N-(3-methylsulfonylpropyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 81226430 |
| Molecular Formula | C10H13ClN2O3S |
| Molecular Weight | 276.74 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 4-chloro-N-(3-methylsulfonylpropyl)pyridine-3-carboxamide |
| SMILES | CS(=O)(=O)CCCNC(=O)c1cnccc1Cl |
| InChI | InChI=1S/C10H13ClN2O3S/c1-17(15,16)6-2-4-13-10(14)8-7-12-5-3-9(8)11/h3,5,7H,2,4,6H2,1H3,(H,13,14) |
| InChIKey | QBJDQDSWQBRVNK-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.74 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|