C10H14N2O4S — CID 81244164
4-(3-methylsulfonylpropylamino)pyridine-3-carboxylic acid (PubChem CID 81244164) has the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. Its IUPAC name is 4-(3-methylsulfonylpropylamino)pyridine-3-carboxylic acid.
| Compound Name | 4-(3-methylsulfonylpropylamino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 81244164 |
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 4-(3-methylsulfonylpropylamino)pyridine-3-carboxylic acid |
| SMILES | CS(=O)(=O)CCCNc1ccncc1C(=O)O |
| InChI | InChI=1S/C10H14N2O4S/c1-17(15,16)6-2-4-12-9-3-5-11-7-8(9)10(13)14/h3,5,7H,2,4,6H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | DWEZYFCIXZMQEI-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|