C13H17ClN2O3 — CID 103871236
methyl 6-[(4-chloropyridine-3-carbonyl)amino]hexanoate (PubChem CID 103871236) has the molecular formula C13H17ClN2O3 and a molecular weight of 284.74 g/mol. Its IUPAC name is methyl 6-[(4-chloropyridine-3-carbonyl)amino]hexanoate.
| Compound Name | methyl 6-[(4-chloropyridine-3-carbonyl)amino]hexanoate |
|---|---|
| PubChem CID | 103871236 |
| Molecular Formula | C13H17ClN2O3 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | methyl 6-[(4-chloropyridine-3-carbonyl)amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)c1cnccc1Cl |
| InChI | InChI=1S/C13H17ClN2O3/c1-19-12(17)5-3-2-4-7-16-13(18)10-9-15-8-6-11(10)14/h6,8-9H,2-5,7H2,1H3,(H,16,18) |
| InChIKey | PJSGZTOTFCSRNN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|