C14H20N2O3 — CID 78951048
methyl 6-[(2-methylpyridine-3-carbonyl)amino]hexanoate (PubChem CID 78951048) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is methyl 6-[(2-methylpyridine-3-carbonyl)amino]hexanoate.
| Compound Name | methyl 6-[(2-methylpyridine-3-carbonyl)amino]hexanoate |
|---|---|
| PubChem CID | 78951048 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | methyl 6-[(2-methylpyridine-3-carbonyl)amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)c1cccnc1C |
| InChI | InChI=1S/C14H20N2O3/c1-11-12(7-6-10-15-11)14(18)16-9-5-3-4-8-13(17)19-2/h6-7,10H,3-5,8-9H2,1-2H3,(H,16,18) |
| InChIKey | BBDYOZZVJXPPHX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|