C14H18N4O3 — CID 103121150
methyl 6-(pyrazolo[1,5-a]pyrazine-3-carbonylamino)hexanoate (PubChem CID 103121150) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is methyl 6-(pyrazolo[1,5-a]pyrazine-3-carbonylamino)hexanoate.
| Compound Name | methyl 6-(pyrazolo[1,5-a]pyrazine-3-carbonylamino)hexanoate |
|---|---|
| PubChem CID | 103121150 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | methyl 6-(pyrazolo[1,5-a]pyrazine-3-carbonylamino)hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)c1cnn2ccncc12 |
| InChI | InChI=1S/C14H18N4O3/c1-21-13(19)5-3-2-4-6-16-14(20)11-9-17-18-8-7-15-10-12(11)18/h7-10H,2-6H2,1H3,(H,16,20) |
| InChIKey | IVOILSIPNWCZPM-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|