C11H13ClN4O — CID 106845452
N-(4-chlorobutyl)pyrazolo[1,5-a]pyrazine-3-carboxamide (PubChem CID 106845452) has the molecular formula C11H13ClN4O and a molecular weight of 252.70 g/mol. Its IUPAC name is N-(4-chlorobutyl)pyrazolo[1,5-a]pyrazine-3-carboxamide.
| Compound Name | N-(4-chlorobutyl)pyrazolo[1,5-a]pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 106845452 |
| Molecular Formula | C11H13ClN4O |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | N-(4-chlorobutyl)pyrazolo[1,5-a]pyrazine-3-carboxamide |
| SMILES | O=C(NCCCCCl)c1cnn2ccncc12 |
| InChI | InChI=1S/C11H13ClN4O/c12-3-1-2-4-14-11(17)9-7-15-16-6-5-13-8-10(9)16/h5-8H,1-4H2,(H,14,17) |
| InChIKey | ZZGKIMHQMLRKSE-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|