C12H17N5O2 — CID 106243450
N-(3-amino-4-methoxybutyl)pyrazolo[1,5-a]pyrazine-3-carboxamide (PubChem CID 106243450) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is N-(3-amino-4-methoxybutyl)pyrazolo[1,5-a]pyrazine-3-carboxamide.
| Compound Name | N-(3-amino-4-methoxybutyl)pyrazolo[1,5-a]pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 106243450 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | N-(3-amino-4-methoxybutyl)pyrazolo[1,5-a]pyrazine-3-carboxamide |
| SMILES | COCC(N)CCNC(=O)c1cnn2ccncc12 |
| InChI | InChI=1S/C12H17N5O2/c1-19-8-9(13)2-3-15-12(18)10-6-16-17-5-4-14-7-11(10)17/h4-7,9H,2-3,8,13H2,1H3,(H,15,18) |
| InChIKey | JQPSMLLLBIYVRB-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |