C12H12N4O — CID 103122096
N-pent-3-ynylpyrazolo[1,5-a]pyrazine-3-carboxamide (PubChem CID 103122096) has the molecular formula C12H12N4O and a molecular weight of 228.25 g/mol. Its IUPAC name is N-pent-3-ynylpyrazolo[1,5-a]pyrazine-3-carboxamide.
| Compound Name | N-pent-3-ynylpyrazolo[1,5-a]pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 103122096 |
| Molecular Formula | C12H12N4O |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | N-pent-3-ynylpyrazolo[1,5-a]pyrazine-3-carboxamide |
| SMILES | CC#CCCNC(=O)c1cnn2ccncc12 |
| InChI | InChI=1S/C12H12N4O/c1-2-3-4-5-14-12(17)10-8-15-16-7-6-13-9-11(10)16/h6-9H,4-5H2,1H3,(H,14,17) |
| InChIKey | DGWQVQOCJCZFEZ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|