C13H19ClN4O — CID 81225983
4-chloro-N-[2-(4-methylpiperazin-1-yl)ethyl]pyridine-3-carboxamide (PubChem CID 81225983) has the molecular formula C13H19ClN4O and a molecular weight of 282.77 g/mol. Its IUPAC name is 4-chloro-N-[2-(4-methylpiperazin-1-yl)ethyl]pyridine-3-carboxamide.
| Compound Name | 4-chloro-N-[2-(4-methylpiperazin-1-yl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 81225983 |
| Molecular Formula | C13H19ClN4O |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 4-chloro-N-[2-(4-methylpiperazin-1-yl)ethyl]pyridine-3-carboxamide |
| SMILES | CN1CCN(CCNC(=O)c2cnccc2Cl)CC1 |
| InChI | InChI=1S/C13H19ClN4O/c1-17-6-8-18(9-7-17)5-4-16-13(19)11-10-15-3-2-12(11)14/h2-3,10H,4-9H2,1H3,(H,16,19) |
| InChIKey | MHVDZJQCIPYVPU-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |