C11H15ClN2O2S — CID 115869248
4-chloro-N-(3-methylsulfinylbutyl)pyridine-3-carboxamide (PubChem CID 115869248) has the molecular formula C11H15ClN2O2S and a molecular weight of 274.77 g/mol. Its IUPAC name is 4-chloro-N-(3-methylsulfinylbutyl)pyridine-3-carboxamide.
| Compound Name | 4-chloro-N-(3-methylsulfinylbutyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 115869248 |
| Molecular Formula | C11H15ClN2O2S |
| Molecular Weight | 274.77 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 4-chloro-N-(3-methylsulfinylbutyl)pyridine-3-carboxamide |
| SMILES | CC(CCNC(=O)c1cnccc1Cl)S(C)=O |
| InChI | InChI=1S/C11H15ClN2O2S/c1-8(17(2)16)3-6-14-11(15)9-7-13-5-4-10(9)12/h4-5,7-8H,3,6H2,1-2H3,(H,14,15) |
| InChIKey | YONWAXJFKYQYLP-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.77 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |