C11H15NO — CID 11030369
1-(2,6-dimethyl-3-pyridinyl)-2-methylpropan-1-one (PubChem CID 11030369) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 1-(2,6-dimethyl-3-pyridinyl)-2-methylpropan-1-one.
| Compound Name | 1-(2,6-dimethyl-3-pyridinyl)-2-methylpropan-1-one |
|---|---|
| PubChem CID | 11030369 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 1-(2,6-dimethyl-3-pyridinyl)-2-methylpropan-1-one |
| SMILES | Cc1ccc(C(=O)C(C)C)c(C)n1 |
| InChI | InChI=1S/C11H15NO/c1-7(2)11(13)10-6-5-8(3)12-9(10)4/h5-7H,1-4H3 |
| InChIKey | SYMCLUIVATYZMR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |