C10H9NO — CID 105108206
1-(2,6-dimethyl-3-pyridinyl)prop-2-yn-1-one (PubChem CID 105108206) has the molecular formula C10H9NO and a molecular weight of 159.19 g/mol. Its IUPAC name is 1-(2,6-dimethyl-3-pyridinyl)prop-2-yn-1-one.
| Compound Name | 1-(2,6-dimethyl-3-pyridinyl)prop-2-yn-1-one |
|---|---|
| PubChem CID | 105108206 |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | 1-(2,6-dimethyl-3-pyridinyl)prop-2-yn-1-one |
| SMILES | C#CC(=O)c1ccc(C)nc1C |
| InChI | InChI=1S/C10H9NO/c1-4-10(12)9-6-5-7(2)11-8(9)3/h1,5-6H,2-3H3 |
| InChIKey | DJHGYVGWTBPITJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|