C8H11ClN2O — CID 67300853
2,6-dimethylpyridine-3-carboxamide;hydrochloride (PubChem CID 67300853) has the molecular formula C8H11ClN2O and a molecular weight of 186.64 g/mol. Its IUPAC name is 2,6-dimethylpyridine-3-carboxamide;hydrochloride.
| Compound Name | 2,6-dimethylpyridine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 67300853 |
| Molecular Formula | C8H11ClN2O |
| Molecular Weight | 186.64 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 2,6-dimethylpyridine-3-carboxamide;hydrochloride |
| SMILES | Cc1ccc(C(N)=O)c(C)n1.Cl |
| InChI | InChI=1S/C8H10N2O.ClH/c1-5-3-4-7(8(9)11)6(2)10-5;/h3-4H,1-2H3,(H2,9,11);1H |
| InChIKey | ZQUILCHJYZZKGZ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.64 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |