C8H10N2O — CID 2824850
2,6-dimethylpyridine-3-carboxamide (PubChem CID 2824850) has the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. Its IUPAC name is 2,6-dimethylpyridine-3-carboxamide.
| Compound Name | 2,6-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 2824850 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 2,6-dimethylpyridine-3-carboxamide |
| SMILES | Cc1ccc(C(N)=O)c(C)n1 |
| InChI | InChI=1S/C8H10N2O/c1-5-3-4-7(8(9)11)6(2)10-5/h3-4H,1-2H3,(H2,9,11) |
| InChIKey | MPQHBWNDIOJYNP-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |