C11H15N — CID 143880197
3-[(Z)-but-2-en-2-yl]-2,6-dimethylpyridine (PubChem CID 143880197) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is 3-[(Z)-but-2-en-2-yl]-2,6-dimethylpyridine.
| Compound Name | 3-[(Z)-but-2-en-2-yl]-2,6-dimethylpyridine |
|---|---|
| PubChem CID | 143880197 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 3-[(Z)-but-2-en-2-yl]-2,6-dimethylpyridine |
| SMILES | C/C=C(/C)c1ccc(C)nc1C |
| InChI | InChI=1S/C11H15N/c1-5-8(2)11-7-6-9(3)12-10(11)4/h5-7H,1-4H3/b8-5- |
| InChIKey | XDMPPSXMCLGZRC-YVMONPNESA-N |
| XLogP | 3.12 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |