C11H7BrFNOS — CID 115796156
1-(4-bromo-3-fluorophenyl)-2-(1,3-thiazol-5-yl)ethanone (PubChem CID 115796156) has the molecular formula C11H7BrFNOS and a molecular weight of 300.15 g/mol. Its IUPAC name is 1-(4-bromo-3-fluorophenyl)-2-(1,3-thiazol-5-yl)ethanone.
| Compound Name | 1-(4-bromo-3-fluorophenyl)-2-(1,3-thiazol-5-yl)ethanone |
|---|---|
| PubChem CID | 115796156 |
| Molecular Formula | C11H7BrFNOS |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 298.94 |
| IUPAC Name | 1-(4-bromo-3-fluorophenyl)-2-(1,3-thiazol-5-yl)ethanone |
| SMILES | O=C(Cc1cncs1)c1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C11H7BrFNOS/c12-9-2-1-7(3-10(9)13)11(15)4-8-5-14-6-16-8/h1-3,5-6H,4H2 |
| InChIKey | XFNUHVGUCJQSLW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |