C11H9FN2OS — CID 116575762
2-(2-amino-1,3-thiazol-4-yl)-1-(3-fluorophenyl)ethanone (PubChem CID 116575762) has the molecular formula C11H9FN2OS and a molecular weight of 236.27 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-1-(3-fluorophenyl)ethanone.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-1-(3-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 116575762 |
| Molecular Formula | C11H9FN2OS |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-1-(3-fluorophenyl)ethanone |
| SMILES | Nc1nc(CC(=O)c2cccc(F)c2)cs1 |
| InChI | InChI=1S/C11H9FN2OS/c12-8-3-1-2-7(4-8)10(15)5-9-6-16-11(13)14-9/h1-4,6H,5H2,(H2,13,14) |
| InChIKey | UUTAQJVUUGEASR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |