C18H16FN3OS — CID 131899873
N-[2-(2-amino-1,3-thiazol-4-yl)ethyl]-4-(3-fluorophenyl)benzamide (PubChem CID 131899873) has the molecular formula C18H16FN3OS and a molecular weight of 341.41 g/mol. Its IUPAC name is N-[2-(2-amino-1,3-thiazol-4-yl)ethyl]-4-(3-fluorophenyl)benzamide.
| Compound Name | N-[2-(2-amino-1,3-thiazol-4-yl)ethyl]-4-(3-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 131899873 |
| Molecular Formula | C18H16FN3OS |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | N-[2-(2-amino-1,3-thiazol-4-yl)ethyl]-4-(3-fluorophenyl)benzamide |
| SMILES | Nc1nc(CCNC(=O)c2ccc(-c3cccc(F)c3)cc2)cs1 |
| InChI | InChI=1S/C18H16FN3OS/c19-15-3-1-2-14(10-15)12-4-6-13(7-5-12)17(23)21-9-8-16-11-24-18(20)22-16/h1-7,10-11H,8-9H2,(H2,20,22)(H,21,23) |
| InChIKey | ANXBNARSQCTHMW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |