C19H19N3O2S — CID 119071037
N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-3-(4-hydroxyphenyl)benzamide (PubChem CID 119071037) has the molecular formula C19H19N3O2S and a molecular weight of 353.45 g/mol. Its IUPAC name is N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-3-(4-hydroxyphenyl)benzamide.
| Compound Name | N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-3-(4-hydroxyphenyl)benzamide |
|---|---|
| PubChem CID | 119071037 |
| Molecular Formula | C19H19N3O2S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-3-(4-hydroxyphenyl)benzamide |
| SMILES | Nc1nc(CCCNC(=O)c2cccc(-c3ccc(O)cc3)c2)cs1 |
| InChI | InChI=1S/C19H19N3O2S/c20-19-22-16(12-25-19)5-2-10-21-18(24)15-4-1-3-14(11-15)13-6-8-17(23)9-7-13/h1,3-4,6-9,11-12,23H,2,5,10H2,(H2,20,22)(H,21,24) |
| InChIKey | VTNYSTHSTKQMMC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|