C17H24N4OS — CID 50973098
N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-(dimethylamino)-2-(3-methylphenyl)acetamide (PubChem CID 50973098) has the molecular formula C17H24N4OS and a molecular weight of 332.47 g/mol. Its IUPAC name is N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-(dimethylamino)-2-(3-methylphenyl)acetamide.
| Compound Name | N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-(dimethylamino)-2-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 50973098 |
| Molecular Formula | C17H24N4OS |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-(dimethylamino)-2-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(C(C(=O)NCCCc2csc(N)n2)N(C)C)c1 |
| InChI | InChI=1S/C17H24N4OS/c1-12-6-4-7-13(10-12)15(21(2)3)16(22)19-9-5-8-14-11-23-17(18)20-14/h4,6-7,10-11,15H,5,8-9H2,1-3H3,(H2,18,20)(H,19,22) |
| InChIKey | WQOMTAVWFMKZDC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|