C17H23N5OS — CID 72861699
N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-pyridin-3-yl-2-pyrrolidin-1-ylacetamide (PubChem CID 72861699) has the molecular formula C17H23N5OS and a molecular weight of 345.47 g/mol. Its IUPAC name is N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-pyridin-3-yl-2-pyrrolidin-1-ylacetamide.
| Compound Name | N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-pyridin-3-yl-2-pyrrolidin-1-ylacetamide |
|---|---|
| PubChem CID | 72861699 |
| Molecular Formula | C17H23N5OS |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-pyridin-3-yl-2-pyrrolidin-1-ylacetamide |
| SMILES | Nc1nc(CCCNC(=O)C(c2cccnc2)N2CCCC2)cs1 |
| InChI | InChI=1S/C17H23N5OS/c18-17-21-14(12-24-17)6-4-8-20-16(23)15(22-9-1-2-10-22)13-5-3-7-19-11-13/h3,5,7,11-12,15H,1-2,4,6,8-10H2,(H2,18,21)(H,20,23) |
| InChIKey | PYLAIZCPLJXSGT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|