C13H18N2O — CID 116860071
1-piperidin-1-yl-1-pyridin-3-ylpropan-2-one (PubChem CID 116860071) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 1-piperidin-1-yl-1-pyridin-3-ylpropan-2-one.
| Compound Name | 1-piperidin-1-yl-1-pyridin-3-ylpropan-2-one |
|---|---|
| PubChem CID | 116860071 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 1-piperidin-1-yl-1-pyridin-3-ylpropan-2-one |
| SMILES | CC(=O)C(c1cccnc1)N1CCCCC1 |
| InChI | InChI=1S/C13H18N2O/c1-11(16)13(12-6-5-7-14-10-12)15-8-3-2-4-9-15/h5-7,10,13H,2-4,8-9H2,1H3 |
| InChIKey | OTSNLSMCOGLKAQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |