C20H25N5O2 — CID 97284567
(2R)-2-pyridin-3-yl-1-[4-(1H-pyrrole-2-carbonyl)piperazin-1-yl]-2-pyrrolidin-1-ylethanone (PubChem CID 97284567) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is (2R)-2-pyridin-3-yl-1-[4-(1H-pyrrole-2-carbonyl)piperazin-1-yl]-2-pyrrolidin-1-ylethanone.
| Compound Name | (2R)-2-pyridin-3-yl-1-[4-(1H-pyrrole-2-carbonyl)piperazin-1-yl]-2-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 97284567 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | (2R)-2-pyridin-3-yl-1-[4-(1H-pyrrole-2-carbonyl)piperazin-1-yl]-2-pyrrolidin-1-ylethanone |
| SMILES | O=C(c1ccc[nH]1)N1CCN(C(=O)[C@@H](c2cccnc2)N2CCCC2)CC1 |
| InChI | InChI=1S/C20H25N5O2/c26-19(17-6-4-8-22-17)24-11-13-25(14-12-24)20(27)18(23-9-1-2-10-23)16-5-3-7-21-15-16/h3-8,15,18,22H,1-2,9-14H2/t18-/m1/s1 |
| InChIKey | XVAYJHJALLLSHY-GOSISDBHSA-N |
| XLogP | 1.53 |
| TPSA | 72.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |