C15H21N3O2S — CID 74230397
2-morpholin-4-yl-2-pyridin-3-yl-1-thiomorpholin-4-ylethanone (PubChem CID 74230397) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is 2-morpholin-4-yl-2-pyridin-3-yl-1-thiomorpholin-4-ylethanone.
| Compound Name | 2-morpholin-4-yl-2-pyridin-3-yl-1-thiomorpholin-4-ylethanone |
|---|---|
| PubChem CID | 74230397 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 2-morpholin-4-yl-2-pyridin-3-yl-1-thiomorpholin-4-ylethanone |
| SMILES | O=C(C(c1cccnc1)N1CCOCC1)N1CCSCC1 |
| InChI | InChI=1S/C15H21N3O2S/c19-15(18-6-10-21-11-7-18)14(13-2-1-3-16-12-13)17-4-8-20-9-5-17/h1-3,12,14H,4-11H2 |
| InChIKey | STXYDZKACYHXQV-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |