C15H19N3O3 — CID 71083509
1-(2-morpholin-4-yl-2-oxo-1-pyridin-3-ylethyl)pyrrolidin-2-one (PubChem CID 71083509) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is 1-(2-morpholin-4-yl-2-oxo-1-pyridin-3-ylethyl)pyrrolidin-2-one.
| Compound Name | 1-(2-morpholin-4-yl-2-oxo-1-pyridin-3-ylethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 71083509 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 1-(2-morpholin-4-yl-2-oxo-1-pyridin-3-ylethyl)pyrrolidin-2-one |
| SMILES | O=C(C(c1cccnc1)N1CCCC1=O)N1CCOCC1 |
| InChI | InChI=1S/C15H19N3O3/c19-13-4-2-6-18(13)14(12-3-1-5-16-11-12)15(20)17-7-9-21-10-8-17/h1,3,5,11,14H,2,4,6-10H2 |
| InChIKey | PYGAXUOGYHVKCO-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |