C19H29N3O2S — CID 97188095
(2R)-N-(2-cyclohexylsulfanylethyl)-2-morpholin-4-yl-2-pyridin-3-ylacetamide (PubChem CID 97188095) has the molecular formula C19H29N3O2S and a molecular weight of 363.53 g/mol. Its IUPAC name is (2R)-N-(2-cyclohexylsulfanylethyl)-2-morpholin-4-yl-2-pyridin-3-ylacetamide.
| Compound Name | (2R)-N-(2-cyclohexylsulfanylethyl)-2-morpholin-4-yl-2-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 97188095 |
| Molecular Formula | C19H29N3O2S |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | (2R)-N-(2-cyclohexylsulfanylethyl)-2-morpholin-4-yl-2-pyridin-3-ylacetamide |
| SMILES | O=C(NCCSC1CCCCC1)[C@@H](c1cccnc1)N1CCOCC1 |
| InChI | InChI=1S/C19H29N3O2S/c23-19(21-9-14-25-17-6-2-1-3-7-17)18(16-5-4-8-20-15-16)22-10-12-24-13-11-22/h4-5,8,15,17-18H,1-3,6-7,9-14H2,(H,21,23)/t18-/m1/s1 |
| InChIKey | PIVGPTGIEKOHBN-GOSISDBHSA-N |
| XLogP | 2.64 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|