C16H22N6O2S — CID 72883606
N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-2-morpholin-4-yl-2-pyridin-3-ylacetamide (PubChem CID 72883606) has the molecular formula C16H22N6O2S and a molecular weight of 362.46 g/mol. Its IUPAC name is N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-2-morpholin-4-yl-2-pyridin-3-ylacetamide.
| Compound Name | N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-2-morpholin-4-yl-2-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 72883606 |
| Molecular Formula | C16H22N6O2S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-2-morpholin-4-yl-2-pyridin-3-ylacetamide |
| SMILES | Cc1nc(SCCNC(=O)C(c2cccnc2)N2CCOCC2)n[nH]1 |
| InChI | InChI=1S/C16H22N6O2S/c1-12-19-16(21-20-12)25-10-5-18-15(23)14(13-3-2-4-17-11-13)22-6-8-24-9-7-22/h2-4,11,14H,5-10H2,1H3,(H,18,23)(H,19,20,21) |
| InChIKey | AGSPSNFKMAGRFS-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|