C16H23N3O3 — CID 97203648
(2R)-2-morpholin-4-yl-1-(1,4-oxazepan-4-yl)-2-pyridin-3-ylethanone (PubChem CID 97203648) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is (2R)-2-morpholin-4-yl-1-(1,4-oxazepan-4-yl)-2-pyridin-3-ylethanone.
| Compound Name | (2R)-2-morpholin-4-yl-1-(1,4-oxazepan-4-yl)-2-pyridin-3-ylethanone |
|---|---|
| PubChem CID | 97203648 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | (2R)-2-morpholin-4-yl-1-(1,4-oxazepan-4-yl)-2-pyridin-3-ylethanone |
| SMILES | O=C([C@@H](c1cccnc1)N1CCOCC1)N1CCCOCC1 |
| InChI | InChI=1S/C16H23N3O3/c20-16(19-5-2-9-21-12-8-19)15(14-3-1-4-17-13-14)18-6-10-22-11-7-18/h1,3-4,13,15H,2,5-12H2/t15-/m1/s1 |
| InChIKey | INZWKVIJDOXPAN-OAHLLOKOSA-N |
| XLogP | 0.70 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |